About 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide
3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide (PubChem CID 137470800) has the molecular formula C10H20F3NO2S
and a molecular weight of 275.34 g/mol. Its IUPAC name is 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide |
| PubChem CID | 137470800 |
| Molecular Formula | C10H20F3NO2S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide |
| SMILES | CC(C)CCS(=O)(=O)NC(C(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2S/c1-7(2)5-6-17(15,16)14-9(8(3)4)10(11,12)13/h7-9,14H,5-6H2,1-4H3 |
| InChIKey | MLDMREULRFBARS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide?
The IUPAC name of 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide (CID 137470800) is 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide.
What is the SMILES notation for 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide?
The canonical SMILES for 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide is CC(C)CCS(=O)(=O)NC(C(C)C)C(F)(F)F.
What is the InChIKey of 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide?
The InChIKey is MLDMREULRFBARS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NO2S/c1-7(2)5-6-17(15,16)14-9(8(3)4)10(11,12)13/h7-9,14H,5-6H2,1-4H3.
What are the key properties of 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide?
3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide has a molecular weight of 275.34 g/mol, XLogP of 2.54, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(1,1,1-trifluoro-3-methylbutan-2-yl)butane-1-sulfonamide is sourced from PubChem (CID 137470800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).