About 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine
4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine (PubChem CID 137471054) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine.
Molecular Properties
| Compound Name | 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine |
| PubChem CID | 137471054 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine |
| SMILES | C=C(CC(=C)N(C)NC1=CCCC=C1)NC |
| InChI | InChI=1S/C13H21N3/c1-11(14-3)10-12(2)16(4)15-13-8-6-5-7-9-13/h6,8-9,14-15H,1-2,5,7,10H2,3-4H3 |
| InChIKey | XUNFKUFOXOVBCA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine?
The IUPAC name of 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine (CID 137471054) is 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine.
What is the SMILES notation for 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine?
The canonical SMILES for 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine is C=C(CC(=C)N(C)NC1=CCCC=C1)NC.
What is the InChIKey of 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine?
The InChIKey is XUNFKUFOXOVBCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3/c1-11(14-3)10-12(2)16(4)15-13-8-6-5-7-9-13/h6,8-9,14-15H,1-2,5,7,10H2,3-4H3.
What are the key properties of 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine?
4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine has a molecular weight of 219.33 g/mol, XLogP of 2.29, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(cyclohexa-1,5-dien-1-ylamino)-methylamino]-N-methylpenta-1,4-dien-2-amine is sourced from PubChem (CID 137471054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).