C15H7F5N2 — CID 137471576
N-(2,3,4,5,6-pentafluorophenyl)isoquinolin-3-amine (PubChem CID 137471576) has the molecular formula C15H7F5N2 and a molecular weight of 310.23 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)isoquinolin-3-amine.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)isoquinolin-3-amine |
|---|---|
| PubChem CID | 137471576 |
| Molecular Formula | C15H7F5N2 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)isoquinolin-3-amine |
| SMILES | Fc1c(F)c(F)c(Nc2cc3ccccc3cn2)c(F)c1F |
| InChI | InChI=1S/C15H7F5N2/c16-10-11(17)13(19)15(14(20)12(10)18)22-9-5-7-3-1-2-4-8(7)6-21-9/h1-6H,(H,21,22) |
| InChIKey | FRXSCZYAEYLHNY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|