C29H35N5O — CID 137472586
7,8-dimethyl-6-[5-[(1R,5S)-8-(oxetan-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]-3-propan-2-yl-1H-indol-2-yl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 137472586) has the molecular formula C29H35N5O and a molecular weight of 469.63 g/mol. Its IUPAC name is 7,8-dimethyl-6-[5-[(1R,5S)-8-(oxetan-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]-3-propan-2-yl-1H-indol-2-yl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 7,8-dimethyl-6-[5-[(1R,5S)-8-(oxetan-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]-3-propan-2-yl-1H-indol-2-yl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 137472586 |
| Molecular Formula | C29H35N5O |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 7,8-dimethyl-6-[5-[(1R,5S)-8-(oxetan-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]-3-propan-2-yl-1H-indol-2-yl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1c(-c2[nH]c3ccc(C4C[C@H]5CC[C@@H](C4)N5C4COC4)cc3c2C(C)C)cn2cnnc2c1C |
| InChI | InChI=1S/C29H35N5O/c1-16(2)27-24-11-19(20-9-21-6-7-22(10-20)34(21)23-13-35-14-23)5-8-26(24)31-28(27)25-12-33-15-30-32-29(33)18(4)17(25)3/h5,8,11-12,15-16,20-23,31H,6-7,9-10,13-14H2,1-4H3/t20?,21-,22+ |
| InChIKey | FMESRRSSSJJDIV-FRIKZZABSA-N |
| XLogP | 5.73 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |