C20H14F4N6O2 — CID 137472668
(2,2-difluoroethanimidoyl) 2-[4-(2,6-difluoro-4-pyridinyl)-1-methylpyrazol-3-yl]-3-oxo-1H-isoindole-5-carboximidate (PubChem CID 137472668) has the molecular formula C20H14F4N6O2 and a molecular weight of 446.36 g/mol. Its IUPAC name is (2,2-difluoroethanimidoyl) 2-[4-(2,6-difluoro-4-pyridinyl)-1-methylpyrazol-3-yl]-3-oxo-1H-isoindole-5-carboximidate.
| Compound Name | (2,2-difluoroethanimidoyl) 2-[4-(2,6-difluoro-4-pyridinyl)-1-methylpyrazol-3-yl]-3-oxo-1H-isoindole-5-carboximidate |
|---|---|
| PubChem CID | 137472668 |
| Molecular Formula | C20H14F4N6O2 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (2,2-difluoroethanimidoyl) 2-[4-(2,6-difluoro-4-pyridinyl)-1-methylpyrazol-3-yl]-3-oxo-1H-isoindole-5-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])C(F)F)c1ccc2c(c1)C(=O)N(c1nn(C)cc1-c1cc(F)nc(F)c1)C2 |
| InChI | InChI=1S/C20H14F4N6O2/c1-29-8-13(11-5-14(21)27-15(22)6-11)19(28-29)30-7-10-3-2-9(4-12(10)20(30)31)17(25)32-18(26)16(23)24/h2-6,8,16,25-26H,7H2,1H3/b25-17-,26-18+ |
| InChIKey | RLGWMURYFBAEGO-WTHRLWDASA-N |
| XLogP | 3.51 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|