C24H22F2N6O2 — CID 137472672
6-[2-(difluoromethyl)-2,3-dihydro-1,3,4-oxadiazol-5-yl]-2-[(1E)-1-(methylamino)-2-pyrazolo[1,5-a]pyridin-7-ylpenta-1,4-dien-3-yl]-3H-isoindol-1-one (PubChem CID 137472672) has the molecular formula C24H22F2N6O2 and a molecular weight of 464.48 g/mol. Its IUPAC name is 6-[2-(difluoromethyl)-2,3-dihydro-1,3,4-oxadiazol-5-yl]-2-[(1E)-1-(methylamino)-2-pyrazolo[1,5-a]pyridin-7-ylpenta-1,4-dien-3-yl]-3H-isoindol-1-one.
| Compound Name | 6-[2-(difluoromethyl)-2,3-dihydro-1,3,4-oxadiazol-5-yl]-2-[(1E)-1-(methylamino)-2-pyrazolo[1,5-a]pyridin-7-ylpenta-1,4-dien-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 137472672 |
| Molecular Formula | C24H22F2N6O2 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 6-[2-(difluoromethyl)-2,3-dihydro-1,3,4-oxadiazol-5-yl]-2-[(1E)-1-(methylamino)-2-pyrazolo[1,5-a]pyridin-7-ylpenta-1,4-dien-3-yl]-3H-isoindol-1-one |
| SMILES | C=CC(/C(=C\NC)c1cccc2ccnn12)N1Cc2ccc(C3=NNC(C(F)F)O3)cc2C1=O |
| InChI | InChI=1S/C24H22F2N6O2/c1-3-19(18(12-27-2)20-6-4-5-16-9-10-28-32(16)20)31-13-15-8-7-14(11-17(15)24(31)33)22-29-30-23(34-22)21(25)26/h3-12,19,21,23,27,30H,1,13H2,2H3/b18-12+ |
| InChIKey | WLQQVYAUFKRUKZ-LDADJPATSA-N |
| XLogP | 2.98 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|