C21H19F3N4O4 — CID 137472684
(2,2-difluoroethanimidoyl) 6-[(4R)-4-(2-fluorophenoxy)oxan-3-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridine-3-carboximidate (PubChem CID 137472684) has the molecular formula C21H19F3N4O4 and a molecular weight of 448.40 g/mol. Its IUPAC name is (2,2-difluoroethanimidoyl) 6-[(4R)-4-(2-fluorophenoxy)oxan-3-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridine-3-carboximidate.
| Compound Name | (2,2-difluoroethanimidoyl) 6-[(4R)-4-(2-fluorophenoxy)oxan-3-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 137472684 |
| Molecular Formula | C21H19F3N4O4 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (2,2-difluoroethanimidoyl) 6-[(4R)-4-(2-fluorophenoxy)oxan-3-yl]-5-oxo-7H-pyrrolo[3,4-b]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])C(F)F)c1cnc2c(c1)C(=O)N(C1COCC[C@H]1Oc1ccccc1F)C2 |
| InChI | InChI=1S/C21H19F3N4O4/c22-13-3-1-2-4-16(13)31-17-5-6-30-10-15(17)28-9-14-12(21(28)29)7-11(8-27-14)19(25)32-20(26)18(23)24/h1-4,7-8,15,17-18,25-26H,5-6,9-10H2/b25-19-,26-20+/t15?,17-/m1/s1 |
| InChIKey | BQTZTOUWWKICRO-VEWMHEKGSA-N |
| XLogP | 3.00 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|