C53H33N5 — CID 137472762
9-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]benzo[b][1,10]phenanthroline (PubChem CID 137472762) has the molecular formula C53H33N5 and a molecular weight of 739.88 g/mol. Its IUPAC name is 9-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]benzo[b][1,10]phenanthroline.
| Compound Name | 9-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]benzo[b][1,10]phenanthroline |
|---|---|
| PubChem CID | 137472762 |
| Molecular Formula | C53H33N5 |
| Molecular Weight | 739.88 g/mol |
| Exact Mass | 739.27 |
| IUPAC Name | 9-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]benzo[b][1,10]phenanthroline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc(-c5ccc(-c6ccc7nc8c(ccc9cccnc98)cc7c6)cc5)c5ccccc45)cc3)n2)cc1 |
| InChI | InChI=1S/C53H33N5/c1-3-10-38(11-4-1)51-56-52(39-12-5-2-6-13-39)58-53(57-51)40-24-21-36(22-25-40)45-29-28-44(46-15-7-8-16-47(45)46)35-19-17-34(18-20-35)41-27-30-48-43(32-41)33-42-26-23-37-14-9-31-54-49(37)50(42)55-48/h1-33H |
| InChIKey | OGGKGCOTWYRVFS-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.88 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|