About N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide
N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide (PubChem CID 137472774) has the molecular formula C10H22N4
and a molecular weight of 198.31 g/mol. Its IUPAC name is N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide.
Molecular Properties
| Compound Name | N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide |
| PubChem CID | 137472774 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide |
| SMILES | CCN(C)N/C(CC/C(C)=N/C)=N/C |
| InChI | InChI=1S/C10H22N4/c1-6-14(5)13-10(12-4)8-7-9(2)11-3/h6-8H2,1-5H3,(H,12,13)/b11-9+ |
| InChIKey | XKALKEUQLCLGFO-PKNBQFBNSA-N |
| XLogP | 1.34 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide?
The IUPAC name of N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide (CID 137472774) is N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide.
What is the SMILES notation for N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide?
The canonical SMILES for N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide is CCN(C)N/C(CC/C(C)=N/C)=N/C.
What is the InChIKey of N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide?
The InChIKey is XKALKEUQLCLGFO-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H22N4/c1-6-14(5)13-10(12-4)8-7-9(2)11-3/h6-8H2,1-5H3,(H,12,13)/b11-9+.
What are the key properties of N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide?
N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide has a molecular weight of 198.31 g/mol, XLogP of 1.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[ethyl(methyl)amino]-N'-methyl-4-methyliminopentanimidamide is sourced from PubChem (CID 137472774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).