C21H27ClO6 — CID 137472802
(1S,2S,4R,5R,6R,7R,8R,10S,12S)-5-chloro-6-hydroxy-7-methoxy-1-methyl-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadec-13(17)-en-16-one (PubChem CID 137472802) has the molecular formula C21H27ClO6 and a molecular weight of 410.89 g/mol. Its IUPAC name is (1S,2S,4R,5R,6R,7R,8R,10S,12S)-5-chloro-6-hydroxy-7-methoxy-1-methyl-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadec-13(17)-en-16-one.
| Compound Name | (1S,2S,4R,5R,6R,7R,8R,10S,12S)-5-chloro-6-hydroxy-7-methoxy-1-methyl-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadec-13(17)-en-16-one |
|---|---|
| PubChem CID | 137472802 |
| Molecular Formula | C21H27ClO6 |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (1S,2S,4R,5R,6R,7R,8R,10S,12S)-5-chloro-6-hydroxy-7-methoxy-1-methyl-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadec-13(17)-en-16-one |
| SMILES | CO[C@@H]1[C@](O)(C(C)C)[C@H](Cl)[C@@H]2O[C@]23[C@]12O[C@H]2C[C@H]1C2=C(CC[C@@]13C)C(=O)OC2 |
| InChI | InChI=1S/C21H27ClO6/c1-9(2)19(24)14(22)15-21(28-15)18(3)6-5-10-11(8-26-16(10)23)12(18)7-13-20(21,27-13)17(19)25-4/h9,12-15,17,24H,5-8H2,1-4H3/t12-,13-,14+,15-,17+,18-,19-,20+,21+/m0/s1 |
| InChIKey | JVHAQJLAQNKOCO-VWZLKGQMSA-N |
| XLogP | 1.96 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|