About N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine
N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine (PubChem CID 137472883) has the molecular formula C18H18N2
and a molecular weight of 262.36 g/mol. Its IUPAC name is N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine.
Molecular Properties
| Compound Name | N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine |
| PubChem CID | 137472883 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine |
| SMILES | C=c1ccccc(=C)nc2c(/N=C/C)c(C)ccc2c1 |
| InChI | InChI=1S/C18H18N2/c1-5-19-17-14(3)10-11-16-12-13(2)8-6-7-9-15(4)20-18(16)17/h5-12H,2,4H2,1,3H3/b8-6-,9-7-,16-12-,19-5+,20-18+ |
| InChIKey | KYDAOODXJMZUQB-ULJFFHQISA-N |
| XLogP | 3.21 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine?
The IUPAC name of N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine (CID 137472883) is N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine.
What is the SMILES notation for N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine?
The canonical SMILES for N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine is C=c1ccccc(=C)nc2c(/N=C/C)c(C)ccc2c1.
What is the InChIKey of N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine?
The InChIKey is KYDAOODXJMZUQB-ULJFFHQISA-N. The full InChI is InChI=1S/C18H18N2/c1-5-19-17-14(3)10-11-16-12-13(2)8-6-7-9-15(4)20-18(16)17/h5-12H,2,4H2,1,3H3/b8-6-,9-7-,16-12-,19-5+,20-18+.
What are the key properties of N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine?
N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine has a molecular weight of 262.36 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(11-methyl-2,7-dimethylidene-1-benzazecin-12-yl)ethanimine is sourced from PubChem (CID 137472883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).