About 4-methylcyclopentane-1,3-dithione
4-methylcyclopentane-1,3-dithione (PubChem CID 137473199) has the molecular formula C6H8S2
and a molecular weight of 144.26 g/mol. Its IUPAC name is 4-methylcyclopentane-1,3-dithione.
Molecular Properties
| Compound Name | 4-methylcyclopentane-1,3-dithione |
| PubChem CID | 137473199 |
| Molecular Formula | C6H8S2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.01 |
| IUPAC Name | 4-methylcyclopentane-1,3-dithione |
| SMILES | CC1CC(=S)CC1=S |
| InChI | InChI=1S/C6H8S2/c1-4-2-5(7)3-6(4)8/h4H,2-3H2,1H3 |
| InChIKey | GRHXBUBYHPADET-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methylcyclopentane-1,3-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclopentane-1,3-dithione?
The IUPAC name of 4-methylcyclopentane-1,3-dithione (CID 137473199) is 4-methylcyclopentane-1,3-dithione.
What is the SMILES notation for 4-methylcyclopentane-1,3-dithione?
The canonical SMILES for 4-methylcyclopentane-1,3-dithione is CC1CC(=S)CC1=S.
What is the InChIKey of 4-methylcyclopentane-1,3-dithione?
The InChIKey is GRHXBUBYHPADET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8S2/c1-4-2-5(7)3-6(4)8/h4H,2-3H2,1H3.
What are the key properties of 4-methylcyclopentane-1,3-dithione?
4-methylcyclopentane-1,3-dithione has a molecular weight of 144.26 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclopentane-1,3-dithione is sourced from PubChem (CID 137473199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).