C25H40O4 — CID 137474054
ethyl (4R)-4-[(1R,2S,5R,6S,8R,10S,11S,14S)-14-hydroxy-11-methyl-7-oxapentacyclo[8.8.0.02,6.06,8.011,16]octadecan-5-yl]pentanoate (PubChem CID 137474054) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is ethyl (4R)-4-[(1R,2S,5R,6S,8R,10S,11S,14S)-14-hydroxy-11-methyl-7-oxapentacyclo[8.8.0.02,6.06,8.011,16]octadecan-5-yl]pentanoate.
| Compound Name | ethyl (4R)-4-[(1R,2S,5R,6S,8R,10S,11S,14S)-14-hydroxy-11-methyl-7-oxapentacyclo[8.8.0.02,6.06,8.011,16]octadecan-5-yl]pentanoate |
|---|---|
| PubChem CID | 137474054 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | ethyl (4R)-4-[(1R,2S,5R,6S,8R,10S,11S,14S)-14-hydroxy-11-methyl-7-oxapentacyclo[8.8.0.02,6.06,8.011,16]octadecan-5-yl]pentanoate |
| SMILES | CCOC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](O)CC[C@]4(C)[C@H]3C[C@H]3O[C@]132 |
| InChI | InChI=1S/C25H40O4/c1-4-28-23(27)10-5-15(2)19-8-9-20-18-7-6-16-13-17(26)11-12-24(16,3)21(18)14-22-25(19,20)29-22/h15-22,26H,4-14H2,1-3H3/t15-,16?,17+,18+,19-,20+,21+,22-,24+,25+/m1/s1 |
| InChIKey | ABMDZMIUKORXPK-JGEUWRQYSA-N |
| XLogP | 4.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|