About (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal
(2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal (PubChem CID 137474263) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal.
Molecular Properties
| Compound Name | (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal |
| PubChem CID | 137474263 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal |
| SMILES | C[C@H](C=O)CCN1CCOC1=O |
| InChI | InChI=1S/C8H13NO3/c1-7(6-10)2-3-9-4-5-12-8(9)11/h6-7H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | SXMDGHKWWFMRCE-ZETCQYMHSA-N |
| XLogP | 0.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal?
The IUPAC name of (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal (CID 137474263) is (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal.
What is the SMILES notation for (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal?
The canonical SMILES for (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal is C[C@H](C=O)CCN1CCOC1=O.
What is the InChIKey of (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal?
The InChIKey is SXMDGHKWWFMRCE-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H13NO3/c1-7(6-10)2-3-9-4-5-12-8(9)11/h6-7H,2-5H2,1H3/t7-/m0/s1.
What are the key properties of (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal?
(2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal has a molecular weight of 171.20 g/mol, XLogP of 0.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-4-(2-oxo-1,3-oxazolidin-3-yl)butanal is sourced from PubChem (CID 137474263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).