C10H13F10NO — CID 137474495
N,1,2,2-tetrafluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methylbutan-1-amine (PubChem CID 137474495) has the molecular formula C10H13F10NO and a molecular weight of 353.20 g/mol. Its IUPAC name is N,1,2,2-tetrafluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methylbutan-1-amine.
| Compound Name | N,1,2,2-tetrafluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 137474495 |
| Molecular Formula | C10H13F10NO |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N,1,2,2-tetrafluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methylbutan-1-amine |
| SMILES | CC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N(C)F |
| InChI | InChI=1S/C10H13F10NO/c1-4(8(13,14)6(11)10(17,18)19)22-5(2)9(15,16)7(12)21(3)20/h4-7H,1-3H3 |
| InChIKey | WXMMLKDBEGRJKS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|