C14H18F12N2O — CID 137474503
1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-4-fluoropiperazine (PubChem CID 137474503) has the molecular formula C14H18F12N2O and a molecular weight of 458.29 g/mol. Its IUPAC name is 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-4-fluoropiperazine.
| Compound Name | 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-4-fluoropiperazine |
|---|---|
| PubChem CID | 137474503 |
| Molecular Formula | C14H18F12N2O |
| Molecular Weight | 458.29 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]-4-fluoropiperazine |
| SMILES | CC(OC(C)C(F)(C(F)N1CCN(F)CC1)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C14H18F12N2O/c1-7(29-8(2)12(18,19)9(15)13(20,21)22)11(17,14(23,24)25)10(16)27-3-5-28(26)6-4-27/h7-10H,3-6H2,1-2H3 |
| InChIKey | YKADCPSHHCEIFB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|