C8H6F13NO — CID 137474702
N,N,1,1,1,3,3-heptafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-amine (PubChem CID 137474702) has the molecular formula C8H6F13NO and a molecular weight of 379.12 g/mol. Its IUPAC name is N,N,1,1,1,3,3-heptafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-amine.
| Compound Name | N,N,1,1,1,3,3-heptafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-amine |
|---|---|
| PubChem CID | 137474702 |
| Molecular Formula | C8H6F13NO |
| Molecular Weight | 379.12 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | N,N,1,1,1,3,3-heptafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-amine |
| SMILES | FC(C(F)(F)F)C(F)(F)COCC(F)(F)C(N(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F13NO/c9-3(7(14,15)16)5(10,11)1-23-2-6(12,13)4(22(20)21)8(17,18)19/h3-4H,1-2H2 |
| InChIKey | UAFNFVNBAAGYOO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|