About 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine
1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine (PubChem CID 137475016) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine.
Molecular Properties
| Compound Name | 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine |
| PubChem CID | 137475016 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine |
| SMILES | CC/N=C(\C)[C@@H]1C=CC(C2CCC(C)(C)CC2)CC1 |
| InChI | InChI=1S/C18H31N/c1-5-19-14(2)15-6-8-16(9-7-15)17-10-12-18(3,4)13-11-17/h6,8,15-17H,5,7,9-13H2,1-4H3/b19-14+/t15-,16?/m1/s1 |
| InChIKey | JSYSDRVCMDDNQK-UBIDPJRXSA-N |
| XLogP | 5.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine?
The IUPAC name of 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine (CID 137475016) is 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine.
What is the SMILES notation for 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine?
The canonical SMILES for 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine is CC/N=C(\C)[C@@H]1C=CC(C2CCC(C)(C)CC2)CC1.
What is the InChIKey of 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine?
The InChIKey is JSYSDRVCMDDNQK-UBIDPJRXSA-N. The full InChI is InChI=1S/C18H31N/c1-5-19-14(2)15-6-8-16(9-7-15)17-10-12-18(3,4)13-11-17/h6,8,15-17H,5,7,9-13H2,1-4H3/b19-14+/t15-,16?/m1/s1.
What are the key properties of 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine?
1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine has a molecular weight of 261.45 g/mol, XLogP of 5.27, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-4-(4,4-dimethylcyclohexyl)cyclohex-2-en-1-yl]-N-ethylethanimine is sourced from PubChem (CID 137475016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).