C35H38N6O5 — CID 137475234
4-[[5-[3-[[4-(dimethylamino)benzoyl]amino]-2-methylphenyl]-1-methyl-2-oxo-3-pyridinyl]amino]-N-(2-methoxyethyl)-2-(prop-2-enoylamino)benzamide (PubChem CID 137475234) has the molecular formula C35H38N6O5 and a molecular weight of 622.73 g/mol. Its IUPAC name is 4-[[5-[3-[[4-(dimethylamino)benzoyl]amino]-2-methylphenyl]-1-methyl-2-oxo-3-pyridinyl]amino]-N-(2-methoxyethyl)-2-(prop-2-enoylamino)benzamide.
| Compound Name | 4-[[5-[3-[[4-(dimethylamino)benzoyl]amino]-2-methylphenyl]-1-methyl-2-oxo-3-pyridinyl]amino]-N-(2-methoxyethyl)-2-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 137475234 |
| Molecular Formula | C35H38N6O5 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | 4-[[5-[3-[[4-(dimethylamino)benzoyl]amino]-2-methylphenyl]-1-methyl-2-oxo-3-pyridinyl]amino]-N-(2-methoxyethyl)-2-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(-c3cccc(NC(=O)c4ccc(N(C)C)cc4)c3C)cn(C)c2=O)ccc1C(=O)NCCOC |
| InChI | InChI=1S/C35H38N6O5/c1-7-32(42)38-30-20-25(13-16-28(30)34(44)36-17-18-46-6)37-31-19-24(21-41(5)35(31)45)27-9-8-10-29(22(27)2)39-33(43)23-11-14-26(15-12-23)40(3)4/h7-16,19-21,37H,1,17-18H2,2-6H3,(H,36,44)(H,38,42)(H,39,43) |
| InChIKey | JDAWYWDCYKPLMX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|