C29H33N3O2 — CID 137475500
(2E,3Z)-2-ethylidene-N-[(3E,5E)-6-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-methyl-6-oxo-3-pyridinyl]-5-methylocta-1,3,5,7-tetraen-4-yl]hexa-3,5-dienamide (PubChem CID 137475500) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-N-[(3E,5E)-6-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-methyl-6-oxo-3-pyridinyl]-5-methylocta-1,3,5,7-tetraen-4-yl]hexa-3,5-dienamide.
| Compound Name | (2E,3Z)-2-ethylidene-N-[(3E,5E)-6-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-methyl-6-oxo-3-pyridinyl]-5-methylocta-1,3,5,7-tetraen-4-yl]hexa-3,5-dienamide |
|---|---|
| PubChem CID | 137475500 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | (2E,3Z)-2-ethylidene-N-[(3E,5E)-6-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-methyl-6-oxo-3-pyridinyl]-5-methylocta-1,3,5,7-tetraen-4-yl]hexa-3,5-dienamide |
| SMILES | C=C/C=C\C(=C/C)C(=O)NC(=C/C=C)/C(C)=C(\C=C)c1cc(N/C(C=C)=C/C=C)c(=O)n(C)c1 |
| InChI | InChI=1S/C29H33N3O2/c1-9-15-18-22(12-4)28(33)31-26(17-11-3)21(7)25(14-6)23-19-27(29(34)32(8)20-23)30-24(13-5)16-10-2/h9-20,30H,1-3,5-6H2,4,7-8H3,(H,31,33)/b18-15-,22-12+,24-16+,25-21+,26-17+ |
| InChIKey | IVSBTPWIGBCODK-IZPWCRCSSA-N |
| XLogP | 5.89 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|