C23H27N3O2 — CID 137475859
N-[(3E,5E)-6-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-methyl-6-oxo-3-pyridinyl]-5-methylocta-1,3,5,7-tetraen-4-yl]acetamide (PubChem CID 137475859) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[(3E,5E)-6-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-methyl-6-oxo-3-pyridinyl]-5-methylocta-1,3,5,7-tetraen-4-yl]acetamide.
| Compound Name | N-[(3E,5E)-6-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-methyl-6-oxo-3-pyridinyl]-5-methylocta-1,3,5,7-tetraen-4-yl]acetamide |
|---|---|
| PubChem CID | 137475859 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[(3E,5E)-6-[5-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-methyl-6-oxo-3-pyridinyl]-5-methylocta-1,3,5,7-tetraen-4-yl]acetamide |
| SMILES | C=C/C=C(\C=C)Nc1cc(/C(C=C)=C(C)/C(=C\C=C)NC(C)=O)cn(C)c1=O |
| InChI | InChI=1S/C23H27N3O2/c1-8-12-19(10-3)25-22-14-18(15-26(7)23(22)28)20(11-4)16(5)21(13-9-2)24-17(6)27/h8-15,25H,1-4H2,5-7H3,(H,24,27)/b19-12+,20-16+,21-13+ |
| InChIKey | RWXFXVRLLILEOM-FRVBFDLJSA-N |
| XLogP | 4.22 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|