C30H32N4O8S — CID 137476498
S-phenyl N-[(5aS,6aS,7R,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamothioate (PubChem CID 137476498) has the molecular formula C30H32N4O8S and a molecular weight of 608.67 g/mol. Its IUPAC name is S-phenyl N-[(5aS,6aS,7R,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamothioate.
| Compound Name | S-phenyl N-[(5aS,6aS,7R,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamothioate |
|---|---|
| PubChem CID | 137476498 |
| Molecular Formula | C30H32N4O8S |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | S-phenyl N-[(5aS,6aS,7R,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]carbamothioate |
| SMILES | CN(C)c1cc(NC(=O)Sc2ccccc2)c(O)c2c1C[C@@H]1C[C@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H32N4O8S/c1-33(2)18-12-17(32-29(41)43-14-8-6-5-7-9-14)23(35)20-15(18)10-13-11-16-22(34(3)4)25(37)21(28(31)40)27(39)30(16,42)26(38)19(13)24(20)36/h5-9,12-13,16,22,35-36,39,42H,10-11H2,1-4H3,(H2,31,40)(H,32,41)/t13-,16+,22-,30-/m1/s1 |
| InChIKey | BYYNWOMTUWWOAH-BYFPVHRUSA-N |
| XLogP | 2.35 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|