About 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate
2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate (PubChem CID 137477109) has the molecular formula C11H14FNO2S
and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate |
| PubChem CID | 137477109 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate |
| SMILES | CSC(C)COC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO2S/c1-8(16-2)7-15-11(14)13-10-5-3-9(12)4-6-10/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | LCISIQQVCWPPFG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate?
The IUPAC name of 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate (CID 137477109) is 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate.
What is the SMILES notation for 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate?
The canonical SMILES for 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate is CSC(C)COC(=O)Nc1ccc(F)cc1.
What is the InChIKey of 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate?
The InChIKey is LCISIQQVCWPPFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO2S/c1-8(16-2)7-15-11(14)13-10-5-3-9(12)4-6-10/h3-6,8H,7H2,1-2H3,(H,13,14).
What are the key properties of 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate?
2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate has a molecular weight of 243.30 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylpropyl N-(4-fluorophenyl)carbamate is sourced from PubChem (CID 137477109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).