C32H19NO4 — CID 137477114
2-[[6-(N-phenylanilino)furo[3,2-b][1]benzofuran-2-yl]methylidene]indene-1,3-dione (PubChem CID 137477114) has the molecular formula C32H19NO4 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-[[6-(N-phenylanilino)furo[3,2-b][1]benzofuran-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[6-(N-phenylanilino)furo[3,2-b][1]benzofuran-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 137477114 |
| Molecular Formula | C32H19NO4 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 2-[[6-(N-phenylanilino)furo[3,2-b][1]benzofuran-2-yl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2cc3oc4cc(N(c5ccccc5)c5ccccc5)ccc4c3o2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C32H19NO4/c34-30-24-13-7-8-14-25(24)31(35)27(30)18-23-19-29-32(36-23)26-16-15-22(17-28(26)37-29)33(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-19H |
| InChIKey | ZWSGZFFTBHXESU-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 63.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|