C18H21IN2O4S — CID 137477360
tert-butyl N-[[5-(5-iodosulfanyl-1,2-oxazol-3-yl)-3,4-dihydro-1H-isochromen-1-yl]methyl]carbamate (PubChem CID 137477360) has the molecular formula C18H21IN2O4S and a molecular weight of 488.35 g/mol. Its IUPAC name is tert-butyl N-[[5-(5-iodosulfanyl-1,2-oxazol-3-yl)-3,4-dihydro-1H-isochromen-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(5-iodosulfanyl-1,2-oxazol-3-yl)-3,4-dihydro-1H-isochromen-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 137477360 |
| Molecular Formula | C18H21IN2O4S |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | tert-butyl N-[[5-(5-iodosulfanyl-1,2-oxazol-3-yl)-3,4-dihydro-1H-isochromen-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1OCCc2c(-c3cc(SI)on3)cccc21 |
| InChI | InChI=1S/C18H21IN2O4S/c1-18(2,3)24-17(22)20-10-15-13-6-4-5-12(11(13)7-8-23-15)14-9-16(26-19)25-21-14/h4-6,9,15H,7-8,10H2,1-3H3,(H,20,22) |
| InChIKey | KDUICHKUQZFAEC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|