C18H24BrNO4 — CID 137477392
tert-butyl N-[[5-(2-bromoacetyl)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methylcarbamate (PubChem CID 137477392) has the molecular formula C18H24BrNO4 and a molecular weight of 398.30 g/mol. Its IUPAC name is tert-butyl N-[[5-(2-bromoacetyl)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[5-(2-bromoacetyl)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 137477392 |
| Molecular Formula | C18H24BrNO4 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | tert-butyl N-[[5-(2-bromoacetyl)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methylcarbamate |
| SMILES | CN(CC1OCCc2c(C(=O)CBr)cccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24BrNO4/c1-18(2,3)24-17(22)20(4)11-16-14-7-5-6-13(15(21)10-19)12(14)8-9-23-16/h5-7,16H,8-11H2,1-4H3 |
| InChIKey | UEKWTIIJZNTUKJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|