C23H19FN2O3S — CID 137477983
(5Z)-5-[2-[6-(8-fluoronaphthalen-2-yl)-2-oxo-1H-pyridin-3-yl]-3-methylbutylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 137477983) has the molecular formula C23H19FN2O3S and a molecular weight of 422.48 g/mol. Its IUPAC name is (5Z)-5-[2-[6-(8-fluoronaphthalen-2-yl)-2-oxo-1H-pyridin-3-yl]-3-methylbutylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[2-[6-(8-fluoronaphthalen-2-yl)-2-oxo-1H-pyridin-3-yl]-3-methylbutylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 137477983 |
| Molecular Formula | C23H19FN2O3S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (5Z)-5-[2-[6-(8-fluoronaphthalen-2-yl)-2-oxo-1H-pyridin-3-yl]-3-methylbutylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)C(/C=C1\SC(=O)NC1=O)c1ccc(-c2ccc3cccc(F)c3c2)[nH]c1=O |
| InChI | InChI=1S/C23H19FN2O3S/c1-12(2)16(11-20-22(28)26-23(29)30-20)15-8-9-19(25-21(15)27)14-7-6-13-4-3-5-18(24)17(13)10-14/h3-12,16H,1-2H3,(H,25,27)(H,26,28,29)/b20-11- |
| InChIKey | SIHNGHGMKNMOEZ-JAIQZWGSSA-N |
| XLogP | 4.94 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|