C17H21NO6 — CID 137478840
5-[(2Z,4E)-2-hydroxy-5-[methyl-(3-methyl-2-oxobut-3-enyl)amino]penta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 137478840) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 5-[(2Z,4E)-2-hydroxy-5-[methyl-(3-methyl-2-oxobut-3-enyl)amino]penta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2Z,4E)-2-hydroxy-5-[methyl-(3-methyl-2-oxobut-3-enyl)amino]penta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 137478840 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-[(2Z,4E)-2-hydroxy-5-[methyl-(3-methyl-2-oxobut-3-enyl)amino]penta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | C=C(C)C(=O)CN(C)/C=C/C=C(\O)C=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C17H21NO6/c1-11(2)14(20)10-18(5)8-6-7-12(19)9-13-15(21)23-17(3,4)24-16(13)22/h6-9,19H,1,10H2,2-5H3/b8-6+,12-7- |
| InChIKey | ZAOWRGFIWOOZSR-CAQHWUKGSA-N |
| XLogP | 1.78 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|