C19H25NO7 — CID 137478860
4-[[(1E,3Z)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-4-hydroxypenta-1,3-dienyl]-(4-oxobutyl)amino]butanal (PubChem CID 137478860) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-[[(1E,3Z)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-4-hydroxypenta-1,3-dienyl]-(4-oxobutyl)amino]butanal.
| Compound Name | 4-[[(1E,3Z)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-4-hydroxypenta-1,3-dienyl]-(4-oxobutyl)amino]butanal |
|---|---|
| PubChem CID | 137478860 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[[(1E,3Z)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-4-hydroxypenta-1,3-dienyl]-(4-oxobutyl)amino]butanal |
| SMILES | CC1(C)OC(=O)C(=C/C(O)=C/C=C/N(CCCC=O)CCCC=O)C(=O)O1 |
| InChI | InChI=1S/C19H25NO7/c1-19(2)26-17(24)16(18(25)27-19)14-15(23)8-7-11-20(9-3-5-12-21)10-4-6-13-22/h7-8,11-14,23H,3-6,9-10H2,1-2H3/b11-7+,15-8- |
| InChIKey | WLKUQNDPNJCJEJ-WOJXAIDLSA-N |
| XLogP | 1.96 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|