C19H25NO6 — CID 137478861
5-[(2Z,4E)-2-hydroxy-5-[methyl-(5-methyl-4-oxohex-5-enyl)amino]penta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 137478861) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is 5-[(2Z,4E)-2-hydroxy-5-[methyl-(5-methyl-4-oxohex-5-enyl)amino]penta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2Z,4E)-2-hydroxy-5-[methyl-(5-methyl-4-oxohex-5-enyl)amino]penta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 137478861 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 5-[(2Z,4E)-2-hydroxy-5-[methyl-(5-methyl-4-oxohex-5-enyl)amino]penta-2,4-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | C=C(C)C(=O)CCCN(C)/C=C/C=C(\O)C=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C19H25NO6/c1-13(2)16(22)9-7-11-20(5)10-6-8-14(21)12-15-17(23)25-19(3,4)26-18(15)24/h6,8,10,12,21H,1,7,9,11H2,2-5H3/b10-6+,14-8- |
| InChIKey | OUICOYJXDRGKEA-UUIXNEETSA-N |
| XLogP | 2.56 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|