C24H30F3N3O4 — CID 137479092
[7-methoxy-9-(methylamino)-6-(3-pyrrolidin-1-ylpropoxy)-1,2,3,4-tetrahydroacridin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 137479092) has the molecular formula C24H30F3N3O4 and a molecular weight of 481.52 g/mol. Its IUPAC name is [7-methoxy-9-(methylamino)-6-(3-pyrrolidin-1-ylpropoxy)-1,2,3,4-tetrahydroacridin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [7-methoxy-9-(methylamino)-6-(3-pyrrolidin-1-ylpropoxy)-1,2,3,4-tetrahydroacridin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 137479092 |
| Molecular Formula | C24H30F3N3O4 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | [7-methoxy-9-(methylamino)-6-(3-pyrrolidin-1-ylpropoxy)-1,2,3,4-tetrahydroacridin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CNc1c2c(nc3cc(OCCCN4CCCC4)c(OC)cc13)CCCC2OC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H30F3N3O4/c1-28-22-15-13-19(32-2)20(33-12-6-11-30-9-3-4-10-30)14-17(15)29-16-7-5-8-18(21(16)22)34-23(31)24(25,26)27/h13-14,18H,3-12H2,1-2H3,(H,28,29) |
| InChIKey | LRSNSWBGRBNJNH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|