C22H23F3N8O2 — CID 137479281
(9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 137479281) has the molecular formula C22H23F3N8O2 and a molecular weight of 488.47 g/mol. Its IUPAC name is (9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 137479281 |
| Molecular Formula | C22H23F3N8O2 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | (9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | Cc1ccc2c(NC(=O)N3c4nc(C(=O)NC(C)C(F)(F)F)ccc4N4CCC[C@H]3C4)n[nH]c2n1 |
| InChI | InChI=1S/C22H23F3N8O2/c1-11-5-6-14-17(26-11)30-31-18(14)29-21(35)33-13-4-3-9-32(10-13)16-8-7-15(28-19(16)33)20(34)27-12(2)22(23,24)25/h5-8,12-13H,3-4,9-10H2,1-2H3,(H,27,34)(H2,26,29,30,31,35)/t12?,13-/m0/s1 |
| InChIKey | QRNQVFJGOQVAOZ-ABLWVSNPSA-N |
| XLogP | 3.36 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |