About (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide
(S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide (PubChem CID 137479616) has the molecular formula C14H21NO2S
and a molecular weight of 267.39 g/mol. Its IUPAC name is (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide |
| PubChem CID | 137479616 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC1(C)CCc2occc2C1=N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H21NO2S/c1-13(2,3)18(16)15-12-10-7-9-17-11(10)6-8-14(12,4)5/h7,9H,6,8H2,1-5H3/t18-/m0/s1 |
| InChIKey | PBBQVZMFYZMCEE-SFHVURJKSA-N |
| XLogP | 3.50 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide?
The IUPAC name of (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide (CID 137479616) is (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide?
The canonical SMILES for (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide is CC1(C)CCc2occc2C1=N[S@@](=O)C(C)(C)C.
What is the InChIKey of (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide?
The InChIKey is PBBQVZMFYZMCEE-SFHVURJKSA-N. The full InChI is InChI=1S/C14H21NO2S/c1-13(2,3)18(16)15-12-10-7-9-17-11(10)6-8-14(12,4)5/h7,9H,6,8H2,1-5H3/t18-/m0/s1.
What are the key properties of (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide?
(S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide has a molecular weight of 267.39 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-N-(5,5-dimethyl-6,7-dihydro-1-benzofuran-4-ylidene)-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 137479616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).