C21H21FN6O4 — CID 137479638
(2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-aminoquinolin-7-yl)oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 137479638) has the molecular formula C21H21FN6O4 and a molecular weight of 440.44 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-aminoquinolin-7-yl)oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-aminoquinolin-7-yl)oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 137479638 |
| Molecular Formula | C21H21FN6O4 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (2R,3S,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-2-[(2-aminoquinolin-7-yl)oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@@H](COc2ccc3ccc(N)nc3c2)O[C@@H](n2cc(F)c3c(N)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C21H21FN6O4/c1-21(30)14(8-31-11-4-2-10-3-5-15(23)27-13(10)6-11)32-20(17(21)29)28-7-12(22)16-18(24)25-9-26-19(16)28/h2-7,9,14,17,20,29-30H,8H2,1H3,(H2,23,27)(H2,24,25,26)/t14-,17+,20-,21-/m1/s1 |
| InChIKey | XNAPHTQOZUJCQT-GYPMPWGGSA-N |
| XLogP | 1.37 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |