C25H23F5N3O8P — CID 137479769
[3-acetyl-1-[2-[(2S,4R)-4-fluoro-2-[[2-fluoro-3-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]peroxy-methylphosphinic acid (PubChem CID 137479769) has the molecular formula C25H23F5N3O8P and a molecular weight of 619.44 g/mol. Its IUPAC name is [3-acetyl-1-[2-[(2S,4R)-4-fluoro-2-[[2-fluoro-3-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]peroxy-methylphosphinic acid.
| Compound Name | [3-acetyl-1-[2-[(2S,4R)-4-fluoro-2-[[2-fluoro-3-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]peroxy-methylphosphinic acid |
|---|---|
| PubChem CID | 137479769 |
| Molecular Formula | C25H23F5N3O8P |
| Molecular Weight | 619.44 g/mol |
| Exact Mass | 619.11 |
| IUPAC Name | [3-acetyl-1-[2-[(2S,4R)-4-fluoro-2-[[2-fluoro-3-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]indol-6-yl]peroxy-methylphosphinic acid |
| SMILES | CC(=O)c1cn(CC(=O)N2C[C@H](F)C[C@H]2C(=O)Nc2cccc(OC(F)(F)F)c2F)c2cc(OOP(C)(=O)O)ccc12 |
| InChI | InChI=1S/C25H23F5N3O8P/c1-13(34)17-11-32(19-9-15(6-7-16(17)19)40-41-42(2,37)38)12-22(35)33-10-14(26)8-20(33)24(36)31-18-4-3-5-21(23(18)27)39-25(28,29)30/h3-7,9,11,14,20H,8,10,12H2,1-2H3,(H,31,36)(H,37,38)/t14-,20+/m1/s1 |
| InChIKey | FWONDZFUDDQKFC-VLIAUNLRSA-N |
| XLogP | 4.58 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|