C20H19F4N3O4 — CID 137479825
(2R,3S,4R,5R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-3-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 137479825) has the molecular formula C20H19F4N3O4 and a molecular weight of 441.38 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-3-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-3-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 137479825 |
| Molecular Formula | C20H19F4N3O4 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (2R,3S,4R,5R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]-hydroxymethyl]-3-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H](C(O)c2ccc(F)c(C(F)(F)F)c2)[C@@](C)(O)[C@H]1O |
| InChI | InChI=1S/C20H19F4N3O4/c1-9-11-5-6-27(17(11)26-8-25-9)18-15(29)19(2,30)16(31-18)14(28)10-3-4-13(21)12(7-10)20(22,23)24/h3-8,14-16,18,28-30H,1-2H3/t14?,15-,16+,18+,19-/m0/s1 |
| InChIKey | YUOKSWIONSHHRB-FYRXFTQWSA-N |
| XLogP | 2.64 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |