C19H16N6O2 — CID 137479962
(3S)-7-(1-methylindazol-4-yl)-2-oxospiro[1H-pyrido[2,3-b][1,4]oxazine-3,3'-pyrrolidine]-1'-carbonitrile (PubChem CID 137479962) has the molecular formula C19H16N6O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is (3S)-7-(1-methylindazol-4-yl)-2-oxospiro[1H-pyrido[2,3-b][1,4]oxazine-3,3'-pyrrolidine]-1'-carbonitrile.
| Compound Name | (3S)-7-(1-methylindazol-4-yl)-2-oxospiro[1H-pyrido[2,3-b][1,4]oxazine-3,3'-pyrrolidine]-1'-carbonitrile |
|---|---|
| PubChem CID | 137479962 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (3S)-7-(1-methylindazol-4-yl)-2-oxospiro[1H-pyrido[2,3-b][1,4]oxazine-3,3'-pyrrolidine]-1'-carbonitrile |
| SMILES | Cn1ncc2c(-c3cnc4c(c3)NC(=O)[C@@]3(CCN(C#N)C3)O4)cccc21 |
| InChI | InChI=1S/C19H16N6O2/c1-24-16-4-2-3-13(14(16)9-22-24)12-7-15-17(21-8-12)27-19(18(26)23-15)5-6-25(10-19)11-20/h2-4,7-9H,5-6,10H2,1H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | QJGVWJHPIXHZOH-IBGZPJMESA-N |
| XLogP | 1.89 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|