C14H15ClFNO3 — CID 137480146
2-(4-chloro-3-fluorophenoxy)-N-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]acetamide (PubChem CID 137480146) has the molecular formula C14H15ClFNO3 and a molecular weight of 299.73 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenoxy)-N-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]acetamide.
| Compound Name | 2-(4-chloro-3-fluorophenoxy)-N-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]acetamide |
|---|---|
| PubChem CID | 137480146 |
| Molecular Formula | C14H15ClFNO3 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-(4-chloro-3-fluorophenoxy)-N-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NC12CC(CO)(C1)C2 |
| InChI | InChI=1S/C14H15ClFNO3/c15-10-2-1-9(3-11(10)16)20-4-12(19)17-14-5-13(6-14,7-14)8-18/h1-3,18H,4-8H2,(H,17,19) |
| InChIKey | CXDWOJGTKPLELS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |