C24H29FN6OS — CID 137480331
3-amino-N-[(6S)-2-[(3S,4S)-3-(fluoromethyl)-4-(methylamino)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 137480331) has the molecular formula C24H29FN6OS and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-amino-N-[(6S)-2-[(3S,4S)-3-(fluoromethyl)-4-(methylamino)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(6S)-2-[(3S,4S)-3-(fluoromethyl)-4-(methylamino)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 137480331 |
| Molecular Formula | C24H29FN6OS |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 3-amino-N-[(6S)-2-[(3S,4S)-3-(fluoromethyl)-4-(methylamino)pyrrolidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CN[C@@H]1CN(c2ccc3c(n2)CC[C@H](NC(=O)c2sc4nc(C)ccc4c2N)C3)C[C@@H]1CF |
| InChI | InChI=1S/C24H29FN6OS/c1-13-3-6-17-21(26)22(33-24(17)28-13)23(32)29-16-5-7-18-14(9-16)4-8-20(30-18)31-11-15(10-25)19(12-31)27-2/h3-4,6,8,15-16,19,27H,5,7,9-12,26H2,1-2H3,(H,29,32)/t15-,16-,19+/m0/s1 |
| InChIKey | OXFAOOQOIAIXHT-TXPKVOOTSA-N |
| XLogP | 2.86 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |