C24H29FN6O2S — CID 137480357
3-amino-N-[(6R)-2-[(3R,4R)-3-amino-4-(methoxymethyl)pyrrolidin-1-yl]-3-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 137480357) has the molecular formula C24H29FN6O2S and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-amino-N-[(6R)-2-[(3R,4R)-3-amino-4-(methoxymethyl)pyrrolidin-1-yl]-3-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(6R)-2-[(3R,4R)-3-amino-4-(methoxymethyl)pyrrolidin-1-yl]-3-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 137480357 |
| Molecular Formula | C24H29FN6O2S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 3-amino-N-[(6R)-2-[(3R,4R)-3-amino-4-(methoxymethyl)pyrrolidin-1-yl]-3-fluoro-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COC[C@@H]1CN(c2nc3c(cc2F)C[C@H](NC(=O)c2sc4nc(C)ccc4c2N)CC3)C[C@@H]1N |
| InChI | InChI=1S/C24H29FN6O2S/c1-12-3-5-16-20(27)21(34-24(16)28-12)23(32)29-15-4-6-19-13(7-15)8-17(25)22(30-19)31-9-14(11-33-2)18(26)10-31/h3,5,8,14-15,18H,4,6-7,9-11,26-27H2,1-2H3,(H,29,32)/t14-,15+,18-/m0/s1 |
| InChIKey | GWLMLGRYSKJXRA-DAYGRLMNSA-N |
| XLogP | 2.42 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |