[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid

C10H11NO4 — CID 137480448

IUPAC[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid
SMILESO=C(O)N[C@H]1COc2cc(O)ccc2C1
InChIInChI=1S/C10H11NO4/c12-8-2-1-6-3-7(11-10(13)14)5-15-9(6)4-8/h1-2,4,7,11-12H,3,5H2,(H,13,14)/t7-/m1/s1
InChIKeyNNSATLXARGHMGY-SSDOTTSWSA-N
MW209.20 g/mol
LogP0.96
Rot. Bonds1

About [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid

[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid (PubChem CID 137480448) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid.

Molecular Properties

Compound Name[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid
PubChem CID137480448
Molecular FormulaC10H11NO4
Molecular Weight209.20 g/mol
Exact Mass209.07
IUPAC Name[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid
SMILESO=C(O)N[C@H]1COc2cc(O)ccc2C1
InChIInChI=1S/C10H11NO4/c12-8-2-1-6-3-7(11-10(13)14)5-15-9(6)4-8/h1-2,4,7,11-12H,3,5H2,(H,13,14)/t7-/m1/s1
InChIKeyNNSATLXARGHMGY-SSDOTTSWSA-N
XLogP0.96
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.20
LogP ≤ 50.96
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid?
The IUPAC name of [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid (CID 137480448) is [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid.
What is the SMILES notation for [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid?
The canonical SMILES for [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid is O=C(O)N[C@H]1COc2cc(O)ccc2C1.
What is the InChIKey of [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid?
The InChIKey is NNSATLXARGHMGY-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H11NO4/c12-8-2-1-6-3-7(11-10(13)14)5-15-9(6)4-8/h1-2,4,7,11-12H,3,5H2,(H,13,14)/t7-/m1/s1.
What are the key properties of [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid?
[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid has a molecular weight of 209.20 g/mol, XLogP of 0.96, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]carbamic acid is sourced from PubChem (CID 137480448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).