C28H33FN6O4S — CID 137480566
tert-butyl 3-[(3R)-3-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-5-fluoro-3,4-dihydro-2H-pyrano[3,2-c]pyridin-7-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 137480566) has the molecular formula C28H33FN6O4S and a molecular weight of 568.68 g/mol. Its IUPAC name is tert-butyl 3-[(3R)-3-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-5-fluoro-3,4-dihydro-2H-pyrano[3,2-c]pyridin-7-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[(3R)-3-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-5-fluoro-3,4-dihydro-2H-pyrano[3,2-c]pyridin-7-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 137480566 |
| Molecular Formula | C28H33FN6O4S |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | tert-butyl 3-[(3R)-3-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-5-fluoro-3,4-dihydro-2H-pyrano[3,2-c]pyridin-7-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Cc1ccc2c(N)c(C(=O)N[C@H]3COc4cc(N5CC6CCC(C5)N6C(=O)OC(C)(C)C)nc(F)c4C3)sc2n1 |
| InChI | InChI=1S/C28H33FN6O4S/c1-14-5-8-18-22(30)23(40-26(18)31-14)25(36)32-15-9-19-20(38-13-15)10-21(33-24(19)29)34-11-16-6-7-17(12-34)35(16)27(37)39-28(2,3)4/h5,8,10,15-17H,6-7,9,11-13,30H2,1-4H3,(H,32,36)/t15-,16?,17?/m1/s1 |
| InChIKey | POSUTJXXCRQYPF-KLAILNCOSA-N |
| XLogP | 4.04 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|