About 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine
3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 137480985) has the molecular formula C18H22N4
and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine |
| PubChem CID | 137480985 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CCCc1cc(N)nc2c(-c3c(C)cccc3C)c(C)nn12 |
| InChI | InChI=1S/C18H22N4/c1-5-7-14-10-15(19)20-18-17(13(4)21-22(14)18)16-11(2)8-6-9-12(16)3/h6,8-10H,5,7H2,1-4H3,(H2,19,20) |
| InChIKey | WMUHWCCLXICTQC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine?
The IUPAC name of 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine (CID 137480985) is 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine.
What is the SMILES notation for 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine?
The canonical SMILES for 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine is CCCc1cc(N)nc2c(-c3c(C)cccc3C)c(C)nn12.
What is the InChIKey of 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine?
The InChIKey is WMUHWCCLXICTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4/c1-5-7-14-10-15(19)20-18-17(13(4)21-22(14)18)16-11(2)8-6-9-12(16)3/h6,8-10H,5,7H2,1-4H3,(H2,19,20).
What are the key properties of 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine?
3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine has a molecular weight of 294.40 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylphenyl)-2-methyl-7-propylpyrazolo[1,5-a]pyrimidin-5-amine is sourced from PubChem (CID 137480985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).