About 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane
4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane (PubChem CID 137482059) has the molecular formula C23H46N2
and a molecular weight of 350.64 g/mol. Its IUPAC name is 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane.
Molecular Properties
| Compound Name | 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane |
| PubChem CID | 137482059 |
| Molecular Formula | C23H46N2 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.37 |
| IUPAC Name | 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane |
| SMILES | CCN1CCCCCC1C(C)CC1CCCN(C(C)C)C(C(C)C)C1 |
| InChI | InChI=1S/C23H46N2/c1-7-24-14-10-8-9-13-22(24)20(6)16-21-12-11-15-25(19(4)5)23(17-21)18(2)3/h18-23H,7-17H2,1-6H3 |
| InChIKey | MFHGUYTYPFTTTF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane?
The IUPAC name of 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane (CID 137482059) is 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane.
What is the SMILES notation for 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane?
The canonical SMILES for 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane is CCN1CCCCCC1C(C)CC1CCCN(C(C)C)C(C(C)C)C1.
What is the InChIKey of 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane?
The InChIKey is MFHGUYTYPFTTTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46N2/c1-7-24-14-10-8-9-13-22(24)20(6)16-21-12-11-15-25(19(4)5)23(17-21)18(2)3/h18-23H,7-17H2,1-6H3.
What are the key properties of 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane?
4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane has a molecular weight of 350.64 g/mol, XLogP of 5.81, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1-ethylazepan-2-yl)propyl]-1,2-di(propan-2-yl)azepane is sourced from PubChem (CID 137482059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).