C13H14N4O — CID 137482064
(Z)-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazol-1-yl]prop-2-enamide (PubChem CID 137482064) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is (Z)-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazol-1-yl]prop-2-enamide.
| Compound Name | (Z)-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazol-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 137482064 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (Z)-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazol-1-yl]prop-2-enamide |
| SMILES | C=C/C=C\C(=C/C=C)c1ncn(/C=C\C(N)=O)n1 |
| InChI | InChI=1S/C13H14N4O/c1-3-5-7-11(6-4-2)13-15-10-17(16-13)9-8-12(14)18/h3-10H,1-2H2,(H2,14,18)/b7-5-,9-8-,11-6+ |
| InChIKey | IOUTUNLLZBIDAE-NXCNDBCVSA-N |
| XLogP | 1.55 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|