C13H15N5O — CID 137482081
(Z)-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazol-1-yl]prop-2-enehydrazide (PubChem CID 137482081) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is (Z)-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazol-1-yl]prop-2-enehydrazide.
| Compound Name | (Z)-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazol-1-yl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 137482081 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (Z)-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,2,4-triazol-1-yl]prop-2-enehydrazide |
| SMILES | C=C/C=C\C(=C/C=C)c1ncn(/C=C\C(=O)NN)n1 |
| InChI | InChI=1S/C13H15N5O/c1-3-5-7-11(6-4-2)13-15-10-18(17-13)9-8-12(19)16-14/h3-10H,1-2,14H2,(H,16,19)/b7-5-,9-8-,11-6+ |
| InChIKey | YQFGKAZSHKHREY-NXCNDBCVSA-N |
| XLogP | 1.05 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|