C25H44ClF2N3O5S — CID 137482804
(2S,5S)-N-[2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[3-[(2-cyclobutyl-2,2-difluoroethyl)amino]propyl]azepane-2-carboxamide (PubChem CID 137482804) has the molecular formula C25H44ClF2N3O5S and a molecular weight of 572.16 g/mol. Its IUPAC name is (2S,5S)-N-[2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[3-[(2-cyclobutyl-2,2-difluoroethyl)amino]propyl]azepane-2-carboxamide.
| Compound Name | (2S,5S)-N-[2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[3-[(2-cyclobutyl-2,2-difluoroethyl)amino]propyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 137482804 |
| Molecular Formula | C25H44ClF2N3O5S |
| Molecular Weight | 572.16 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | (2S,5S)-N-[2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-[3-[(2-cyclobutyl-2,2-difluoroethyl)amino]propyl]azepane-2-carboxamide |
| SMILES | CS[C@H]1OC(C(NC(=O)[C@@H]2CC[C@H](CCCNCC(F)(F)C3CCC3)CCN2)C(C)Cl)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H44ClF2N3O5S/c1-14(26)18(22-20(33)19(32)21(34)24(36-22)37-2)31-23(35)17-9-8-15(10-12-30-17)5-4-11-29-13-25(27,28)16-6-3-7-16/h14-22,24,29-30,32-34H,3-13H2,1-2H3,(H,31,35)/t14?,15-,17-,18?,19-,20+,21+,22?,24+/m0/s1 |
| InChIKey | DJWPNTNXWPXGEI-IYJKLHBQSA-N |
| XLogP | 1.83 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|