6-amino-4,4,6-trimethylheptanoic acid

C10H21NO2 — CID 137482851

IUPAC6-amino-4,4,6-trimethylheptanoic acid
SMILESCC(C)(N)CC(C)(C)CCC(=O)O
InChIInChI=1S/C10H21NO2/c1-9(2,6-5-8(12)13)7-10(3,4)11/h5-7,11H2,1-4H3,(H,12,13)
InChIKeyUSSSYVKFYGJFHE-UHFFFAOYSA-N
MW187.28 g/mol
LogP2.00
Rot. Bonds5

About 6-amino-4,4,6-trimethylheptanoic acid

6-amino-4,4,6-trimethylheptanoic acid (PubChem CID 137482851) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 6-amino-4,4,6-trimethylheptanoic acid.

Molecular Properties

Compound Name6-amino-4,4,6-trimethylheptanoic acid
PubChem CID137482851
Molecular FormulaC10H21NO2
Molecular Weight187.28 g/mol
Exact Mass187.16
IUPAC Name6-amino-4,4,6-trimethylheptanoic acid
SMILESCC(C)(N)CC(C)(C)CCC(=O)O
InChIInChI=1S/C10H21NO2/c1-9(2,6-5-8(12)13)7-10(3,4)11/h5-7,11H2,1-4H3,(H,12,13)
InChIKeyUSSSYVKFYGJFHE-UHFFFAOYSA-N
XLogP2.00
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.28
LogP ≤ 52.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 6-amino-4,4,6-trimethylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-4,4,6-trimethylheptanoic acid?
The IUPAC name of 6-amino-4,4,6-trimethylheptanoic acid (CID 137482851) is 6-amino-4,4,6-trimethylheptanoic acid.
What is the SMILES notation for 6-amino-4,4,6-trimethylheptanoic acid?
The canonical SMILES for 6-amino-4,4,6-trimethylheptanoic acid is CC(C)(N)CC(C)(C)CCC(=O)O.
What is the InChIKey of 6-amino-4,4,6-trimethylheptanoic acid?
The InChIKey is USSSYVKFYGJFHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-9(2,6-5-8(12)13)7-10(3,4)11/h5-7,11H2,1-4H3,(H,12,13).
What are the key properties of 6-amino-4,4,6-trimethylheptanoic acid?
6-amino-4,4,6-trimethylheptanoic acid has a molecular weight of 187.28 g/mol, XLogP of 2.00, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4,4,6-trimethylheptanoic acid is sourced from PubChem (CID 137482851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).