C20H22F3N3O3S — CID 137483114
1-cyclopentyl-3-[2-phenyl-5-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea (PubChem CID 137483114) has the molecular formula C20H22F3N3O3S and a molecular weight of 441.48 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-phenyl-5-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea.
| Compound Name | 1-cyclopentyl-3-[2-phenyl-5-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 137483114 |
| Molecular Formula | C20H22F3N3O3S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 1-cyclopentyl-3-[2-phenyl-5-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea |
| SMILES | O=C(Nc1cc(S(=O)(=O)NCC(F)(F)F)ccc1-c1ccccc1)NC1CCCC1 |
| InChI | InChI=1S/C20H22F3N3O3S/c21-20(22,23)13-24-30(28,29)16-10-11-17(14-6-2-1-3-7-14)18(12-16)26-19(27)25-15-8-4-5-9-15/h1-3,6-7,10-12,15,24H,4-5,8-9,13H2,(H2,25,26,27) |
| InChIKey | ASZAFYOSWTYTNY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |