About 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide
2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide (PubChem CID 137483146) has the molecular formula C10H21NO4S
and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide |
| PubChem CID | 137483146 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide |
| SMILES | CC(C)(C)COC(C)(C)C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C10H21NO4S/c1-9(2,3)7-15-10(4,5)8(12)11-16(6,13)14/h7H2,1-6H3,(H,11,12) |
| InChIKey | NSGRHPFGRYNVPW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide?
The IUPAC name of 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide (CID 137483146) is 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide.
What is the SMILES notation for 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide?
The canonical SMILES for 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide is CC(C)(C)COC(C)(C)C(=O)NS(C)(=O)=O.
What is the InChIKey of 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide?
The InChIKey is NSGRHPFGRYNVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4S/c1-9(2,3)7-15-10(4,5)8(12)11-16(6,13)14/h7H2,1-6H3,(H,11,12).
What are the key properties of 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide?
2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide has a molecular weight of 251.35 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropoxy)-2-methyl-N-methylsulfonylpropanamide is sourced from PubChem (CID 137483146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).